C17H15BrF3N3O3 — CID 3647257
methyl 2-[(5-bromo-2-pyridinyl)amino]-3,3,3-trifluoro-2-[(2-phenylacetyl)amino]propanoate (PubChem CID 3647257) has the molecular formula C17H15BrF3N3O3 and a molecular weight of 446.22 g/mol. Its IUPAC name is methyl 2-[(5-bromo-2-pyridinyl)amino]-3,3,3-trifluoro-2-[(2-phenylacetyl)amino]propanoate.
| Compound Name | methyl 2-[(5-bromo-2-pyridinyl)amino]-3,3,3-trifluoro-2-[(2-phenylacetyl)amino]propanoate |
|---|---|
| PubChem CID | 3647257 |
| Molecular Formula | C17H15BrF3N3O3 |
| Molecular Weight | 446.22 g/mol |
| Exact Mass | 445.02 |
| IUPAC Name | methyl 2-[(5-bromo-2-pyridinyl)amino]-3,3,3-trifluoro-2-[(2-phenylacetyl)amino]propanoate |
| SMILES | COC(=O)C(NC(=O)Cc1ccccc1)(Nc1ccc(Br)cn1)C(F)(F)F |
| InChI | InChI=1S/C17H15BrF3N3O3/c1-27-15(26)16(17(19,20)21,23-13-8-7-12(18)10-22-13)24-14(25)9-11-5-3-2-4-6-11/h2-8,10H,9H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | XDYIUYVPIJOXIA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.22 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|