C26H27N7O6 — CID 3648542
5-methyl-2-(4-nitrophenyl)-4-[2-[4-[3-(3-nitrophenyl)prop-2-enoyl]piperazin-1-yl]ethyliminomethyl]-1H-pyrazol-3-one (PubChem CID 3648542) has the molecular formula C26H27N7O6 and a molecular weight of 533.55 g/mol. Its IUPAC name is 5-methyl-2-(4-nitrophenyl)-4-[2-[4-[3-(3-nitrophenyl)prop-2-enoyl]piperazin-1-yl]ethyliminomethyl]-1H-pyrazol-3-one.
| Compound Name | 5-methyl-2-(4-nitrophenyl)-4-[2-[4-[3-(3-nitrophenyl)prop-2-enoyl]piperazin-1-yl]ethyliminomethyl]-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 3648542 |
| Molecular Formula | C26H27N7O6 |
| Molecular Weight | 533.55 g/mol |
| Exact Mass | 533.20 |
| IUPAC Name | 5-methyl-2-(4-nitrophenyl)-4-[2-[4-[3-(3-nitrophenyl)prop-2-enoyl]piperazin-1-yl]ethyliminomethyl]-1H-pyrazol-3-one |
| SMILES | Cc1[nH]n(-c2ccc([N+](=O)[O-])cc2)c(=O)c1/C=N/CCN1CCN(C(=O)C=Cc2cccc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C26H27N7O6/c1-19-24(26(35)31(28-19)21-6-8-22(9-7-21)32(36)37)18-27-11-12-29-13-15-30(16-14-29)25(34)10-5-20-3-2-4-23(17-20)33(38)39/h2-10,17-18,28H,11-16H2,1H3/b10-5?,27-18+ |
| InChIKey | JTKIHPSWWQMBIS-RFIINPFGSA-N |
| XLogP | 2.57 |
| TPSA | 159.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.55 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|