C29H24Cl2N6O4S2 — CID 3649067
[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-[2-[[4-(3,4-dichlorophenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3-thiazol-4-yl]methanone (PubChem CID 3649067) has the molecular formula C29H24Cl2N6O4S2 and a molecular weight of 655.59 g/mol. Its IUPAC name is [4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-[2-[[4-(3,4-dichlorophenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3-thiazol-4-yl]methanone.
| Compound Name | [4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-[2-[[4-(3,4-dichlorophenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3-thiazol-4-yl]methanone |
|---|---|
| PubChem CID | 3649067 |
| Molecular Formula | C29H24Cl2N6O4S2 |
| Molecular Weight | 655.59 g/mol |
| Exact Mass | 654.07 |
| IUPAC Name | [4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-[2-[[4-(3,4-dichlorophenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3-thiazol-4-yl]methanone |
| SMILES | O=C(c1csc(CSc2nnc(-c3ccco3)n2-c2ccc(Cl)c(Cl)c2)n1)N1CCN(Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C29H24Cl2N6O4S2/c30-20-5-4-19(13-21(20)31)37-27(24-2-1-11-39-24)33-34-29(37)43-16-26-32-22(15-42-26)28(38)36-9-7-35(8-10-36)14-18-3-6-23-25(12-18)41-17-40-23/h1-6,11-13,15H,7-10,14,16-17H2 |
| InChIKey | YKOBQXVDPQMBIM-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.59 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |