About 2-(4-methylanilino)-4H-1,4-benzothiazin-3-one
2-(4-methylanilino)-4H-1,4-benzothiazin-3-one (PubChem CID 3649400) has the molecular formula C15H14N2OS
and a molecular weight of 270.36 g/mol. Its IUPAC name is 2-(4-methylanilino)-4H-1,4-benzothiazin-3-one.
Molecular Properties
| Compound Name | 2-(4-methylanilino)-4H-1,4-benzothiazin-3-one |
| PubChem CID | 3649400 |
| Molecular Formula | C15H14N2OS |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 2-(4-methylanilino)-4H-1,4-benzothiazin-3-one |
| SMILES | Cc1ccc(NC2Sc3ccccc3NC2=O)cc1 |
| InChI | InChI=1S/C15H14N2OS/c1-10-6-8-11(9-7-10)16-15-14(18)17-12-4-2-3-5-13(12)19-15/h2-9,15-16H,1H3,(H,17,18) |
| InChIKey | CGTIJKGAMZLDAQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-methylanilino)-4H-1,4-benzothiazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylanilino)-4H-1,4-benzothiazin-3-one?
The IUPAC name of 2-(4-methylanilino)-4H-1,4-benzothiazin-3-one (CID 3649400) is 2-(4-methylanilino)-4H-1,4-benzothiazin-3-one.
What is the SMILES notation for 2-(4-methylanilino)-4H-1,4-benzothiazin-3-one?
The canonical SMILES for 2-(4-methylanilino)-4H-1,4-benzothiazin-3-one is Cc1ccc(NC2Sc3ccccc3NC2=O)cc1.
What is the InChIKey of 2-(4-methylanilino)-4H-1,4-benzothiazin-3-one?
The InChIKey is CGTIJKGAMZLDAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2OS/c1-10-6-8-11(9-7-10)16-15-14(18)17-12-4-2-3-5-13(12)19-15/h2-9,15-16H,1H3,(H,17,18).
What are the key properties of 2-(4-methylanilino)-4H-1,4-benzothiazin-3-one?
2-(4-methylanilino)-4H-1,4-benzothiazin-3-one has a molecular weight of 270.36 g/mol, XLogP of 3.48, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylanilino)-4H-1,4-benzothiazin-3-one is sourced from PubChem (CID 3649400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).