About [(2,6-dichlorophenyl)methylideneamino] 2-(2,5-dibromothiophen-3-yl)acetate
[(2,6-dichlorophenyl)methylideneamino] 2-(2,5-dibromothiophen-3-yl)acetate (PubChem CID 3649877) has the molecular formula C13H7Br2Cl2NO2S
and a molecular weight of 471.99 g/mol. Its IUPAC name is [(2,6-dichlorophenyl)methylideneamino] 2-(2,5-dibromothiophen-3-yl)acetate.
Molecular Properties
| Compound Name | [(2,6-dichlorophenyl)methylideneamino] 2-(2,5-dibromothiophen-3-yl)acetate |
| PubChem CID | 3649877 |
| Molecular Formula | C13H7Br2Cl2NO2S |
| Molecular Weight | 471.99 g/mol |
| Exact Mass | 468.79 |
| IUPAC Name | [(2,6-dichlorophenyl)methylideneamino] 2-(2,5-dibromothiophen-3-yl)acetate |
| SMILES | O=C(Cc1cc(Br)sc1Br)ON=Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H7Br2Cl2NO2S/c14-11-4-7(13(15)21-11)5-12(19)20-18-6-8-9(16)2-1-3-10(8)17/h1-4,6H,5H2 |
| InChIKey | MNLVGBTZDIYGMQ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 471.99 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(2,6-dichlorophenyl)methylideneamino] 2-(2,5-dibromothiophen-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2,6-dichlorophenyl)methylideneamino] 2-(2,5-dibromothiophen-3-yl)acetate?
The IUPAC name of [(2,6-dichlorophenyl)methylideneamino] 2-(2,5-dibromothiophen-3-yl)acetate (CID 3649877) is [(2,6-dichlorophenyl)methylideneamino] 2-(2,5-dibromothiophen-3-yl)acetate.
What is the SMILES notation for [(2,6-dichlorophenyl)methylideneamino] 2-(2,5-dibromothiophen-3-yl)acetate?
The canonical SMILES for [(2,6-dichlorophenyl)methylideneamino] 2-(2,5-dibromothiophen-3-yl)acetate is O=C(Cc1cc(Br)sc1Br)ON=Cc1c(Cl)cccc1Cl.
What is the InChIKey of [(2,6-dichlorophenyl)methylideneamino] 2-(2,5-dibromothiophen-3-yl)acetate?
The InChIKey is MNLVGBTZDIYGMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7Br2Cl2NO2S/c14-11-4-7(13(15)21-11)5-12(19)20-18-6-8-9(16)2-1-3-10(8)17/h1-4,6H,5H2.
What are the key properties of [(2,6-dichlorophenyl)methylideneamino] 2-(2,5-dibromothiophen-3-yl)acetate?
[(2,6-dichlorophenyl)methylideneamino] 2-(2,5-dibromothiophen-3-yl)acetate has a molecular weight of 471.99 g/mol, XLogP of 5.70, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2,6-dichlorophenyl)methylideneamino] 2-(2,5-dibromothiophen-3-yl)acetate is sourced from PubChem (CID 3649877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).