C11H7BrF4N2 — CID 3650094
1-(4-bromo-2,3,5,6-tetrafluorophenyl)-3,5-dimethylpyrazole (PubChem CID 3650094) has the molecular formula C11H7BrF4N2 and a molecular weight of 323.09 g/mol. Its IUPAC name is 1-(4-bromo-2,3,5,6-tetrafluorophenyl)-3,5-dimethylpyrazole.
| Compound Name | 1-(4-bromo-2,3,5,6-tetrafluorophenyl)-3,5-dimethylpyrazole |
|---|---|
| PubChem CID | 3650094 |
| Molecular Formula | C11H7BrF4N2 |
| Molecular Weight | 323.09 g/mol |
| Exact Mass | 321.97 |
| IUPAC Name | 1-(4-bromo-2,3,5,6-tetrafluorophenyl)-3,5-dimethylpyrazole |
| SMILES | Cc1cc(C)n(-c2c(F)c(F)c(Br)c(F)c2F)n1 |
| InChI | InChI=1S/C11H7BrF4N2/c1-4-3-5(2)18(17-4)11-9(15)7(13)6(12)8(14)10(11)16/h3H,1-2H3 |
| InChIKey | WMLCBPHIPJNNDM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.09 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|