About 4-ethyl-2-(4-nitrophenyl)-4H-3,1-benzoxazine
4-ethyl-2-(4-nitrophenyl)-4H-3,1-benzoxazine (PubChem CID 3650338) has the molecular formula C16H14N2O3
and a molecular weight of 282.30 g/mol. Its IUPAC name is 4-ethyl-2-(4-nitrophenyl)-4H-3,1-benzoxazine.
Molecular Properties
| Compound Name | 4-ethyl-2-(4-nitrophenyl)-4H-3,1-benzoxazine |
| PubChem CID | 3650338 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 4-ethyl-2-(4-nitrophenyl)-4H-3,1-benzoxazine |
| SMILES | CCC1OC(c2ccc([N+](=O)[O-])cc2)=Nc2ccccc21 |
| InChI | InChI=1S/C16H14N2O3/c1-2-15-13-5-3-4-6-14(13)17-16(21-15)11-7-9-12(10-8-11)18(19)20/h3-10,15H,2H2,1H3 |
| InChIKey | DOHZITNPBBDZMT-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 64.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-2-(4-nitrophenyl)-4H-3,1-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2-(4-nitrophenyl)-4H-3,1-benzoxazine?
The IUPAC name of 4-ethyl-2-(4-nitrophenyl)-4H-3,1-benzoxazine (CID 3650338) is 4-ethyl-2-(4-nitrophenyl)-4H-3,1-benzoxazine.
What is the SMILES notation for 4-ethyl-2-(4-nitrophenyl)-4H-3,1-benzoxazine?
The canonical SMILES for 4-ethyl-2-(4-nitrophenyl)-4H-3,1-benzoxazine is CCC1OC(c2ccc([N+](=O)[O-])cc2)=Nc2ccccc21.
What is the InChIKey of 4-ethyl-2-(4-nitrophenyl)-4H-3,1-benzoxazine?
The InChIKey is DOHZITNPBBDZMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O3/c1-2-15-13-5-3-4-6-14(13)17-16(21-15)11-7-9-12(10-8-11)18(19)20/h3-10,15H,2H2,1H3.
What are the key properties of 4-ethyl-2-(4-nitrophenyl)-4H-3,1-benzoxazine?
4-ethyl-2-(4-nitrophenyl)-4H-3,1-benzoxazine has a molecular weight of 282.30 g/mol, XLogP of 4.15, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2-(4-nitrophenyl)-4H-3,1-benzoxazine is sourced from PubChem (CID 3650338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).