C10H13F7N2O — CID 3650712
1-(4-ethylpiperazin-1-yl)-2,2,3,3,4,4,4-heptafluorobutan-1-one (PubChem CID 3650712) has the molecular formula C10H13F7N2O and a molecular weight of 310.21 g/mol. Its IUPAC name is 1-(4-ethylpiperazin-1-yl)-2,2,3,3,4,4,4-heptafluorobutan-1-one.
| Compound Name | 1-(4-ethylpiperazin-1-yl)-2,2,3,3,4,4,4-heptafluorobutan-1-one |
|---|---|
| PubChem CID | 3650712 |
| Molecular Formula | C10H13F7N2O |
| Molecular Weight | 310.21 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 1-(4-ethylpiperazin-1-yl)-2,2,3,3,4,4,4-heptafluorobutan-1-one |
| SMILES | CCN1CCN(C(=O)C(F)(F)C(F)(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H13F7N2O/c1-2-18-3-5-19(6-4-18)7(20)8(11,12)9(13,14)10(15,16)17/h2-6H2,1H3 |
| InChIKey | WVBNGTBRNIVCNK-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.21 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|