About 2-(2-ethyl-3-oxo-1,4-benzothiazin-4-yl)-N-(2-phenylethyl)acetamide
2-(2-ethyl-3-oxo-1,4-benzothiazin-4-yl)-N-(2-phenylethyl)acetamide (PubChem CID 3650753) has the molecular formula C20H22N2O2S
and a molecular weight of 354.47 g/mol. Its IUPAC name is 2-(2-ethyl-3-oxo-1,4-benzothiazin-4-yl)-N-(2-phenylethyl)acetamide.
Molecular Properties
| Compound Name | 2-(2-ethyl-3-oxo-1,4-benzothiazin-4-yl)-N-(2-phenylethyl)acetamide |
| PubChem CID | 3650753 |
| Molecular Formula | C20H22N2O2S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 2-(2-ethyl-3-oxo-1,4-benzothiazin-4-yl)-N-(2-phenylethyl)acetamide |
| SMILES | CCC1Sc2ccccc2N(CC(=O)NCCc2ccccc2)C1=O |
| InChI | InChI=1S/C20H22N2O2S/c1-2-17-20(24)22(16-10-6-7-11-18(16)25-17)14-19(23)21-13-12-15-8-4-3-5-9-15/h3-11,17H,2,12-14H2,1H3,(H,21,23) |
| InChIKey | HYTXDLZSWFFFCS-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-ethyl-3-oxo-1,4-benzothiazin-4-yl)-N-(2-phenylethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-ethyl-3-oxo-1,4-benzothiazin-4-yl)-N-(2-phenylethyl)acetamide?
The IUPAC name of 2-(2-ethyl-3-oxo-1,4-benzothiazin-4-yl)-N-(2-phenylethyl)acetamide (CID 3650753) is 2-(2-ethyl-3-oxo-1,4-benzothiazin-4-yl)-N-(2-phenylethyl)acetamide.
What is the SMILES notation for 2-(2-ethyl-3-oxo-1,4-benzothiazin-4-yl)-N-(2-phenylethyl)acetamide?
The canonical SMILES for 2-(2-ethyl-3-oxo-1,4-benzothiazin-4-yl)-N-(2-phenylethyl)acetamide is CCC1Sc2ccccc2N(CC(=O)NCCc2ccccc2)C1=O.
What is the InChIKey of 2-(2-ethyl-3-oxo-1,4-benzothiazin-4-yl)-N-(2-phenylethyl)acetamide?
The InChIKey is HYTXDLZSWFFFCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N2O2S/c1-2-17-20(24)22(16-10-6-7-11-18(16)25-17)14-19(23)21-13-12-15-8-4-3-5-9-15/h3-11,17H,2,12-14H2,1H3,(H,21,23).
What are the key properties of 2-(2-ethyl-3-oxo-1,4-benzothiazin-4-yl)-N-(2-phenylethyl)acetamide?
2-(2-ethyl-3-oxo-1,4-benzothiazin-4-yl)-N-(2-phenylethyl)acetamide has a molecular weight of 354.47 g/mol, XLogP of 3.26, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethyl-3-oxo-1,4-benzothiazin-4-yl)-N-(2-phenylethyl)acetamide is sourced from PubChem (CID 3650753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).