About (2R)-2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]cycloheptan-1-one
(2R)-2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]cycloheptan-1-one (PubChem CID 36510129) has the molecular formula C15H17N3OS
and a molecular weight of 287.39 g/mol. Its IUPAC name is (2R)-2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]cycloheptan-1-one.
Molecular Properties
| Compound Name | (2R)-2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]cycloheptan-1-one |
| PubChem CID | 36510129 |
| Molecular Formula | C15H17N3OS |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | (2R)-2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]cycloheptan-1-one |
| SMILES | O=C1CCCCC[C@H]1Sc1nncn1-c1ccccc1 |
| InChI | InChI=1S/C15H17N3OS/c19-13-9-5-2-6-10-14(13)20-15-17-16-11-18(15)12-7-3-1-4-8-12/h1,3-4,7-8,11,14H,2,5-6,9-10H2/t14-/m1/s1 |
| InChIKey | OOJRWORUHOUURY-CQSZACIVSA-N |
| XLogP | 3.26 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2R)-2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]cycloheptan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]cycloheptan-1-one?
The IUPAC name of (2R)-2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]cycloheptan-1-one (CID 36510129) is (2R)-2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]cycloheptan-1-one.
What is the SMILES notation for (2R)-2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]cycloheptan-1-one?
The canonical SMILES for (2R)-2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]cycloheptan-1-one is O=C1CCCCC[C@H]1Sc1nncn1-c1ccccc1.
What is the InChIKey of (2R)-2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]cycloheptan-1-one?
The InChIKey is OOJRWORUHOUURY-CQSZACIVSA-N. The full InChI is InChI=1S/C15H17N3OS/c19-13-9-5-2-6-10-14(13)20-15-17-16-11-18(15)12-7-3-1-4-8-12/h1,3-4,7-8,11,14H,2,5-6,9-10H2/t14-/m1/s1.
What are the key properties of (2R)-2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]cycloheptan-1-one?
(2R)-2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]cycloheptan-1-one has a molecular weight of 287.39 g/mol, XLogP of 3.26, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]cycloheptan-1-one is sourced from PubChem (CID 36510129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).