C14H14BrN3O3S — CID 36511162
[3-[(5-bromo-2-methylphenyl)sulfonylamino]phenyl]urea (PubChem CID 36511162) has the molecular formula C14H14BrN3O3S and a molecular weight of 384.26 g/mol. Its IUPAC name is [3-[(5-bromo-2-methylphenyl)sulfonylamino]phenyl]urea.
| Compound Name | [3-[(5-bromo-2-methylphenyl)sulfonylamino]phenyl]urea |
|---|---|
| PubChem CID | 36511162 |
| Molecular Formula | C14H14BrN3O3S |
| Molecular Weight | 384.26 g/mol |
| Exact Mass | 382.99 |
| IUPAC Name | [3-[(5-bromo-2-methylphenyl)sulfonylamino]phenyl]urea |
| SMILES | Cc1ccc(Br)cc1S(=O)(=O)Nc1cccc(NC(N)=O)c1 |
| InChI | InChI=1S/C14H14BrN3O3S/c1-9-5-6-10(15)7-13(9)22(20,21)18-12-4-2-3-11(8-12)17-14(16)19/h2-8,18H,1H3,(H3,16,17,19) |
| InChIKey | YPZIKKJWTZRRQU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.26 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |