About N-benzyl-4-[(1,5-dimethyl-4-nitropyrazol-3-yl)diazenyl]-N-ethylaniline
N-benzyl-4-[(1,5-dimethyl-4-nitropyrazol-3-yl)diazenyl]-N-ethylaniline (PubChem CID 3651651) has the molecular formula C20H22N6O2
and a molecular weight of 378.44 g/mol. Its IUPAC name is N-benzyl-4-[(1,5-dimethyl-4-nitropyrazol-3-yl)diazenyl]-N-ethylaniline.
Molecular Properties
| Compound Name | N-benzyl-4-[(1,5-dimethyl-4-nitropyrazol-3-yl)diazenyl]-N-ethylaniline |
| PubChem CID | 3651651 |
| Molecular Formula | C20H22N6O2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | N-benzyl-4-[(1,5-dimethyl-4-nitropyrazol-3-yl)diazenyl]-N-ethylaniline |
| SMILES | CCN(Cc1ccccc1)c1ccc(/N=N/c2nn(C)c(C)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H22N6O2/c1-4-25(14-16-8-6-5-7-9-16)18-12-10-17(11-13-18)21-22-20-19(26(27)28)15(2)24(3)23-20/h5-13H,4,14H2,1-3H3/b22-21+ |
| InChIKey | WDERFMIIJYFHQP-QURGRASLSA-N |
| XLogP | 5.08 |
| TPSA | 88.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-4-[(1,5-dimethyl-4-nitropyrazol-3-yl)diazenyl]-N-ethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-4-[(1,5-dimethyl-4-nitropyrazol-3-yl)diazenyl]-N-ethylaniline?
The IUPAC name of N-benzyl-4-[(1,5-dimethyl-4-nitropyrazol-3-yl)diazenyl]-N-ethylaniline (CID 3651651) is N-benzyl-4-[(1,5-dimethyl-4-nitropyrazol-3-yl)diazenyl]-N-ethylaniline.
What is the SMILES notation for N-benzyl-4-[(1,5-dimethyl-4-nitropyrazol-3-yl)diazenyl]-N-ethylaniline?
The canonical SMILES for N-benzyl-4-[(1,5-dimethyl-4-nitropyrazol-3-yl)diazenyl]-N-ethylaniline is CCN(Cc1ccccc1)c1ccc(/N=N/c2nn(C)c(C)c2[N+](=O)[O-])cc1.
What is the InChIKey of N-benzyl-4-[(1,5-dimethyl-4-nitropyrazol-3-yl)diazenyl]-N-ethylaniline?
The InChIKey is WDERFMIIJYFHQP-QURGRASLSA-N. The full InChI is InChI=1S/C20H22N6O2/c1-4-25(14-16-8-6-5-7-9-16)18-12-10-17(11-13-18)21-22-20-19(26(27)28)15(2)24(3)23-20/h5-13H,4,14H2,1-3H3/b22-21+.
What are the key properties of N-benzyl-4-[(1,5-dimethyl-4-nitropyrazol-3-yl)diazenyl]-N-ethylaniline?
N-benzyl-4-[(1,5-dimethyl-4-nitropyrazol-3-yl)diazenyl]-N-ethylaniline has a molecular weight of 378.44 g/mol, XLogP of 5.08, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-4-[(1,5-dimethyl-4-nitropyrazol-3-yl)diazenyl]-N-ethylaniline is sourced from PubChem (CID 3651651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).