About N-hexyl-6,7-dimethoxy-2-methyl-3,4-dihydroisoquinolin-1-imine
N-hexyl-6,7-dimethoxy-2-methyl-3,4-dihydroisoquinolin-1-imine (PubChem CID 3651775) has the molecular formula C18H28N2O2
and a molecular weight of 304.43 g/mol. Its IUPAC name is N-hexyl-6,7-dimethoxy-2-methyl-3,4-dihydroisoquinolin-1-imine.
Molecular Properties
| Compound Name | N-hexyl-6,7-dimethoxy-2-methyl-3,4-dihydroisoquinolin-1-imine |
| PubChem CID | 3651775 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | N-hexyl-6,7-dimethoxy-2-methyl-3,4-dihydroisoquinolin-1-imine |
| SMILES | CCCCCC/N=C1/c2cc(OC)c(OC)cc2CCN1C |
| InChI | InChI=1S/C18H28N2O2/c1-5-6-7-8-10-19-18-15-13-17(22-4)16(21-3)12-14(15)9-11-20(18)2/h12-13H,5-11H2,1-4H3/b19-18- |
| InChIKey | PQPGBTDRDYJQTC-HNENSFHCSA-N |
| XLogP | 3.52 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-hexyl-6,7-dimethoxy-2-methyl-3,4-dihydroisoquinolin-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hexyl-6,7-dimethoxy-2-methyl-3,4-dihydroisoquinolin-1-imine?
The IUPAC name of N-hexyl-6,7-dimethoxy-2-methyl-3,4-dihydroisoquinolin-1-imine (CID 3651775) is N-hexyl-6,7-dimethoxy-2-methyl-3,4-dihydroisoquinolin-1-imine.
What is the SMILES notation for N-hexyl-6,7-dimethoxy-2-methyl-3,4-dihydroisoquinolin-1-imine?
The canonical SMILES for N-hexyl-6,7-dimethoxy-2-methyl-3,4-dihydroisoquinolin-1-imine is CCCCCC/N=C1/c2cc(OC)c(OC)cc2CCN1C.
What is the InChIKey of N-hexyl-6,7-dimethoxy-2-methyl-3,4-dihydroisoquinolin-1-imine?
The InChIKey is PQPGBTDRDYJQTC-HNENSFHCSA-N. The full InChI is InChI=1S/C18H28N2O2/c1-5-6-7-8-10-19-18-15-13-17(22-4)16(21-3)12-14(15)9-11-20(18)2/h12-13H,5-11H2,1-4H3/b19-18-.
What are the key properties of N-hexyl-6,7-dimethoxy-2-methyl-3,4-dihydroisoquinolin-1-imine?
N-hexyl-6,7-dimethoxy-2-methyl-3,4-dihydroisoquinolin-1-imine has a molecular weight of 304.43 g/mol, XLogP of 3.52, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-hexyl-6,7-dimethoxy-2-methyl-3,4-dihydroisoquinolin-1-imine is sourced from PubChem (CID 3651775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).