C19H24F3N3O5 — CID 3651967
N-[1-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-3-methylbutanamide (PubChem CID 3651967) has the molecular formula C19H24F3N3O5 and a molecular weight of 431.41 g/mol. Its IUPAC name is N-[1-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-3-methylbutanamide.
| Compound Name | N-[1-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 3651967 |
| Molecular Formula | C19H24F3N3O5 |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | N-[1-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-3-methylbutanamide |
| SMILES | COc1ccc(CCN2C(=O)NC(NC(=O)CC(C)C)(C(F)(F)F)C2=O)cc1OC |
| InChI | InChI=1S/C19H24F3N3O5/c1-11(2)9-15(26)23-18(19(20,21)22)16(27)25(17(28)24-18)8-7-12-5-6-13(29-3)14(10-12)30-4/h5-6,10-11H,7-9H2,1-4H3,(H,23,26)(H,24,28) |
| InChIKey | FQXPHPVPMZMOJZ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|