About 5-ethyladamantane-1,3-diol
5-ethyladamantane-1,3-diol (PubChem CID 3652070) has the molecular formula C12H20O2
and a molecular weight of 196.29 g/mol. Its IUPAC name is 5-ethyladamantane-1,3-diol.
Molecular Properties
| Compound Name | 5-ethyladamantane-1,3-diol |
| PubChem CID | 3652070 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 5-ethyladamantane-1,3-diol |
| SMILES | CCC12CC3CC(O)(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C12H20O2/c1-2-10-3-9-4-11(13,6-10)8-12(14,5-9)7-10/h9,13-14H,2-8H2,1H3 |
| InChIKey | UBZYZZAIOTYCAB-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-ethyladamantane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyladamantane-1,3-diol?
The IUPAC name of 5-ethyladamantane-1,3-diol (CID 3652070) is 5-ethyladamantane-1,3-diol.
What is the SMILES notation for 5-ethyladamantane-1,3-diol?
The canonical SMILES for 5-ethyladamantane-1,3-diol is CCC12CC3CC(O)(CC(O)(C3)C1)C2.
What is the InChIKey of 5-ethyladamantane-1,3-diol?
The InChIKey is UBZYZZAIOTYCAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O2/c1-2-10-3-9-4-11(13,6-10)8-12(14,5-9)7-10/h9,13-14H,2-8H2,1H3.
What are the key properties of 5-ethyladamantane-1,3-diol?
5-ethyladamantane-1,3-diol has a molecular weight of 196.29 g/mol, XLogP of 1.84, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyladamantane-1,3-diol is sourced from PubChem (CID 3652070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).