C20H23ClN2O4 — CID 36520782
1-[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethyl]-3-(3-phenoxypropyl)urea (PubChem CID 36520782) has the molecular formula C20H23ClN2O4 and a molecular weight of 390.87 g/mol. Its IUPAC name is 1-[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethyl]-3-(3-phenoxypropyl)urea.
| Compound Name | 1-[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethyl]-3-(3-phenoxypropyl)urea |
|---|---|
| PubChem CID | 36520782 |
| Molecular Formula | C20H23ClN2O4 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 1-[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethyl]-3-(3-phenoxypropyl)urea |
| SMILES | O=C(NCCCOc1ccccc1)NCCc1cc(Cl)c2c(c1)OCCO2 |
| InChI | InChI=1S/C20H23ClN2O4/c21-17-13-15(14-18-19(17)27-12-11-26-18)7-9-23-20(24)22-8-4-10-25-16-5-2-1-3-6-16/h1-3,5-6,13-14H,4,7-12H2,(H2,22,23,24) |
| InChIKey | FEJGXTBXSXWGOO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|