About (6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)-(2-fluorophenyl)methanone
(6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)-(2-fluorophenyl)methanone (PubChem CID 3652381) has the molecular formula C24H22FNO3
and a molecular weight of 391.44 g/mol. Its IUPAC name is (6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)-(2-fluorophenyl)methanone.
Molecular Properties
| Compound Name | (6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)-(2-fluorophenyl)methanone |
| PubChem CID | 3652381 |
| Molecular Formula | C24H22FNO3 |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | (6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)-(2-fluorophenyl)methanone |
| SMILES | COc1cc2c(cc1OC)C(c1ccccc1)N(C(=O)c1ccccc1F)CC2 |
| InChI | InChI=1S/C24H22FNO3/c1-28-21-14-17-12-13-26(24(27)18-10-6-7-11-20(18)25)23(16-8-4-3-5-9-16)19(17)15-22(21)29-2/h3-11,14-15,23H,12-13H2,1-2H3 |
| InChIKey | RCROUZKLHAAHNC-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)-(2-fluorophenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)-(2-fluorophenyl)methanone?
The IUPAC name of (6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)-(2-fluorophenyl)methanone (CID 3652381) is (6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)-(2-fluorophenyl)methanone.
What is the SMILES notation for (6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)-(2-fluorophenyl)methanone?
The canonical SMILES for (6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)-(2-fluorophenyl)methanone is COc1cc2c(cc1OC)C(c1ccccc1)N(C(=O)c1ccccc1F)CC2.
What is the InChIKey of (6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)-(2-fluorophenyl)methanone?
The InChIKey is RCROUZKLHAAHNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22FNO3/c1-28-21-14-17-12-13-26(24(27)18-10-6-7-11-20(18)25)23(16-8-4-3-5-9-16)19(17)15-22(21)29-2/h3-11,14-15,23H,12-13H2,1-2H3.
What are the key properties of (6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)-(2-fluorophenyl)methanone?
(6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)-(2-fluorophenyl)methanone has a molecular weight of 391.44 g/mol, XLogP of 4.63, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6,7-dimethoxy-1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)-(2-fluorophenyl)methanone is sourced from PubChem (CID 3652381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).