About N'-(benzenesulfonyl)-N-(2,4-difluorophenyl)benzenecarboximidamide
N'-(benzenesulfonyl)-N-(2,4-difluorophenyl)benzenecarboximidamide (PubChem CID 3652838) has the molecular formula C19H14F2N2O2S
and a molecular weight of 372.40 g/mol. Its IUPAC name is N'-(benzenesulfonyl)-N-(2,4-difluorophenyl)benzenecarboximidamide.
Molecular Properties
| Compound Name | N'-(benzenesulfonyl)-N-(2,4-difluorophenyl)benzenecarboximidamide |
| PubChem CID | 3652838 |
| Molecular Formula | C19H14F2N2O2S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | N'-(benzenesulfonyl)-N-(2,4-difluorophenyl)benzenecarboximidamide |
| SMILES | O=S(=O)(N=C(Nc1ccc(F)cc1F)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H14F2N2O2S/c20-15-11-12-18(17(21)13-15)22-19(14-7-3-1-4-8-14)23-26(24,25)16-9-5-2-6-10-16/h1-13H,(H,22,23) |
| InChIKey | LNRLYLOKSQTKBM-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(benzenesulfonyl)-N-(2,4-difluorophenyl)benzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(benzenesulfonyl)-N-(2,4-difluorophenyl)benzenecarboximidamide?
The IUPAC name of N'-(benzenesulfonyl)-N-(2,4-difluorophenyl)benzenecarboximidamide (CID 3652838) is N'-(benzenesulfonyl)-N-(2,4-difluorophenyl)benzenecarboximidamide.
What is the SMILES notation for N'-(benzenesulfonyl)-N-(2,4-difluorophenyl)benzenecarboximidamide?
The canonical SMILES for N'-(benzenesulfonyl)-N-(2,4-difluorophenyl)benzenecarboximidamide is O=S(=O)(N=C(Nc1ccc(F)cc1F)c1ccccc1)c1ccccc1.
What is the InChIKey of N'-(benzenesulfonyl)-N-(2,4-difluorophenyl)benzenecarboximidamide?
The InChIKey is LNRLYLOKSQTKBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14F2N2O2S/c20-15-11-12-18(17(21)13-15)22-19(14-7-3-1-4-8-14)23-26(24,25)16-9-5-2-6-10-16/h1-13H,(H,22,23).
What are the key properties of N'-(benzenesulfonyl)-N-(2,4-difluorophenyl)benzenecarboximidamide?
N'-(benzenesulfonyl)-N-(2,4-difluorophenyl)benzenecarboximidamide has a molecular weight of 372.40 g/mol, XLogP of 4.21, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(benzenesulfonyl)-N-(2,4-difluorophenyl)benzenecarboximidamide is sourced from PubChem (CID 3652838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).