C30H28N4PtS4 — CID 3653188
bis((benzhydrylideneamino)-[methylsulfanyl(sulfoniumylidene)methyl]azanide);platinum (PubChem CID 3653188) has the molecular formula C30H28N4PtS4 and a molecular weight of 767.93 g/mol. Its IUPAC name is bis((benzhydrylideneamino)-[methylsulfanyl(sulfoniumylidene)methyl]azanide);platinum.
| Compound Name | bis((benzhydrylideneamino)-[methylsulfanyl(sulfoniumylidene)methyl]azanide);platinum |
|---|---|
| PubChem CID | 3653188 |
| Molecular Formula | C30H28N4PtS4 |
| Molecular Weight | 767.93 g/mol |
| Exact Mass | 767.08 |
| IUPAC Name | bis((benzhydrylideneamino)-[methylsulfanyl(sulfoniumylidene)methyl]azanide);platinum |
| SMILES | [H]/[S+]=C(/[N-]N=C(c1ccccc1)c1ccccc1)SC.[H]/[S+]=C(/[N-]N=C(c1ccccc1)c1ccccc1)SC.[Pt] |
| InChI | InChI=1S/2C15H14N2S2.Pt/c2*1-19-15(18)17-16-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13;/h2*2-11H,1H3,(H,17,18); |
| InChIKey | KQDIYUAQZKMZTL-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 52.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.93 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|