C21H26BrN2O+ — CID 3653392
4-bromo-2-[6-(4-ethylphenyl)-2-propan-2-yl-1,2,3,4-tetrahydropyrimidin-3-ium-4-yl]phenol (PubChem CID 3653392) has the molecular formula C21H26BrN2O+ and a molecular weight of 402.36 g/mol. Its IUPAC name is 4-bromo-2-[6-(4-ethylphenyl)-2-propan-2-yl-1,2,3,4-tetrahydropyrimidin-3-ium-4-yl]phenol.
| Compound Name | 4-bromo-2-[6-(4-ethylphenyl)-2-propan-2-yl-1,2,3,4-tetrahydropyrimidin-3-ium-4-yl]phenol |
|---|---|
| PubChem CID | 3653392 |
| Molecular Formula | C21H26BrN2O+ |
| Molecular Weight | 402.36 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 4-bromo-2-[6-(4-ethylphenyl)-2-propan-2-yl-1,2,3,4-tetrahydropyrimidin-3-ium-4-yl]phenol |
| SMILES | CCc1ccc(C2=CC(c3cc(Br)ccc3O)[NH2+]C(C(C)C)N2)cc1 |
| InChI | InChI=1S/C21H25BrN2O/c1-4-14-5-7-15(8-6-14)18-12-19(24-21(23-18)13(2)3)17-11-16(22)9-10-20(17)25/h5-13,19,21,23-25H,4H2,1-3H3/p+1 |
| InChIKey | GNYSQTIZQXAOES-UHFFFAOYSA-O |
| XLogP | 3.95 |
| TPSA | 48.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.36 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|