About 2-thiophen-2-yl-1,3-dioxolane
2-thiophen-2-yl-1,3-dioxolane (PubChem CID 3653561) has the molecular formula C7H8O2S
and a molecular weight of 156.21 g/mol. Its IUPAC name is 2-thiophen-2-yl-1,3-dioxolane.
Molecular Properties
| Compound Name | 2-thiophen-2-yl-1,3-dioxolane |
| PubChem CID | 3653561 |
| Molecular Formula | C7H8O2S |
| Molecular Weight | 156.21 g/mol |
| Exact Mass | 156.02 |
| IUPAC Name | 2-thiophen-2-yl-1,3-dioxolane |
| SMILES | c1csc(C2OCCO2)c1 |
| InChI | InChI=1S/C7H8O2S/c1-2-6(10-5-1)7-8-3-4-9-7/h1-2,5,7H,3-4H2 |
| InChIKey | FHPFDCRNWLVVHD-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.21 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-thiophen-2-yl-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-thiophen-2-yl-1,3-dioxolane?
The IUPAC name of 2-thiophen-2-yl-1,3-dioxolane (CID 3653561) is 2-thiophen-2-yl-1,3-dioxolane.
What is the SMILES notation for 2-thiophen-2-yl-1,3-dioxolane?
The canonical SMILES for 2-thiophen-2-yl-1,3-dioxolane is c1csc(C2OCCO2)c1.
What is the InChIKey of 2-thiophen-2-yl-1,3-dioxolane?
The InChIKey is FHPFDCRNWLVVHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2S/c1-2-6(10-5-1)7-8-3-4-9-7/h1-2,5,7H,3-4H2.
What are the key properties of 2-thiophen-2-yl-1,3-dioxolane?
2-thiophen-2-yl-1,3-dioxolane has a molecular weight of 156.21 g/mol, XLogP of 1.79, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-thiophen-2-yl-1,3-dioxolane is sourced from PubChem (CID 3653561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).