C14H7F7N2O3 — CID 3653766
N-(3-amino-1,4-dioxonaphthalen-2-yl)-2,2,3,3,4,4,4-heptafluorobutanamide (PubChem CID 3653766) has the molecular formula C14H7F7N2O3 and a molecular weight of 384.21 g/mol. Its IUPAC name is N-(3-amino-1,4-dioxonaphthalen-2-yl)-2,2,3,3,4,4,4-heptafluorobutanamide.
| Compound Name | N-(3-amino-1,4-dioxonaphthalen-2-yl)-2,2,3,3,4,4,4-heptafluorobutanamide |
|---|---|
| PubChem CID | 3653766 |
| Molecular Formula | C14H7F7N2O3 |
| Molecular Weight | 384.21 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | N-(3-amino-1,4-dioxonaphthalen-2-yl)-2,2,3,3,4,4,4-heptafluorobutanamide |
| SMILES | NC1=C(NC(=O)C(F)(F)C(F)(F)C(F)(F)F)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C14H7F7N2O3/c15-12(16,13(17,18)14(19,20)21)11(26)23-8-7(22)9(24)5-3-1-2-4-6(5)10(8)25/h1-4H,22H2,(H,23,26) |
| InChIKey | CYHZMICCDYYUQP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.21 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|