C16H14N4O — CID 36542028
N-(2,3-dihydro-1H-inden-5-yl)-2H-benzotriazole-5-carboxamide (PubChem CID 36542028) has the molecular formula C16H14N4O and a molecular weight of 278.31 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-5-yl)-2H-benzotriazole-5-carboxamide.
| Compound Name | N-(2,3-dihydro-1H-inden-5-yl)-2H-benzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 36542028 |
| Molecular Formula | C16H14N4O |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-5-yl)-2H-benzotriazole-5-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)CCC2)c1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C16H14N4O/c21-16(12-5-7-14-15(9-12)19-20-18-14)17-13-6-4-10-2-1-3-11(10)8-13/h4-9H,1-3H2,(H,17,21)(H,18,19,20) |
| InChIKey | LENHBIQCDOGRDH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |