C19H24N2O5S — CID 36544729
N-[(2,3-dimethoxyphenyl)methyl]-3-(ethylsulfamoyl)-N-methylbenzamide (PubChem CID 36544729) has the molecular formula C19H24N2O5S and a molecular weight of 392.48 g/mol. Its IUPAC name is N-[(2,3-dimethoxyphenyl)methyl]-3-(ethylsulfamoyl)-N-methylbenzamide.
| Compound Name | N-[(2,3-dimethoxyphenyl)methyl]-3-(ethylsulfamoyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 36544729 |
| Molecular Formula | C19H24N2O5S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | N-[(2,3-dimethoxyphenyl)methyl]-3-(ethylsulfamoyl)-N-methylbenzamide |
| SMILES | CCNS(=O)(=O)c1cccc(C(=O)N(C)Cc2cccc(OC)c2OC)c1 |
| InChI | InChI=1S/C19H24N2O5S/c1-5-20-27(23,24)16-10-6-8-14(12-16)19(22)21(2)13-15-9-7-11-17(25-3)18(15)26-4/h6-12,20H,5,13H2,1-4H3 |
| InChIKey | WQTGFKYJEPJYJR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |