C21H23N3O6S — CID 3654559
[2-(butylamino)-2-oxoethyl] 2-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]sulfanylpyridine-3-carboxylate (PubChem CID 3654559) has the molecular formula C21H23N3O6S and a molecular weight of 445.50 g/mol. Its IUPAC name is [2-(butylamino)-2-oxoethyl] 2-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]sulfanylpyridine-3-carboxylate.
| Compound Name | [2-(butylamino)-2-oxoethyl] 2-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]sulfanylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 3654559 |
| Molecular Formula | C21H23N3O6S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | [2-(butylamino)-2-oxoethyl] 2-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]sulfanylpyridine-3-carboxylate |
| SMILES | CCCCNC(=O)COC(=O)c1cccnc1SCC(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H23N3O6S/c1-2-3-8-22-18(25)11-28-21(27)15-5-4-9-23-20(15)31-12-19(26)24-14-6-7-16-17(10-14)30-13-29-16/h4-7,9-10H,2-3,8,11-13H2,1H3,(H,22,25)(H,24,26) |
| InChIKey | HNTQMHVEJPZJMR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 115.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|