C19H20Cl2N2O4 — CID 3654647
[2-[2,5-dimethyl-1-(oxolan-2-ylmethyl)pyrrol-3-yl]-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate (PubChem CID 3654647) has the molecular formula C19H20Cl2N2O4 and a molecular weight of 411.29 g/mol. Its IUPAC name is [2-[2,5-dimethyl-1-(oxolan-2-ylmethyl)pyrrol-3-yl]-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate.
| Compound Name | [2-[2,5-dimethyl-1-(oxolan-2-ylmethyl)pyrrol-3-yl]-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 3654647 |
| Molecular Formula | C19H20Cl2N2O4 |
| Molecular Weight | 411.29 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | [2-[2,5-dimethyl-1-(oxolan-2-ylmethyl)pyrrol-3-yl]-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate |
| SMILES | Cc1cc(C(=O)COC(=O)c2nc(Cl)ccc2Cl)c(C)n1CC1CCCO1 |
| InChI | InChI=1S/C19H20Cl2N2O4/c1-11-8-14(12(2)23(11)9-13-4-3-7-26-13)16(24)10-27-19(25)18-15(20)5-6-17(21)22-18/h5-6,8,13H,3-4,7,9-10H2,1-2H3 |
| InChIKey | KRKWSDBXXQOJCI-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.29 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|