2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylacetic acid

C9H8N2O2S2 — CID 3654926

IUPAC2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylacetic acid
SMILESCc1csc2c(SCC(=O)O)ncnc12
InChIInChI=1S/C9H8N2O2S2/c1-5-2-14-8-7(5)10-4-11-9(8)15-3-6(12)13/h2,4H,3H2,1H3,(H,12,13)
InChIKeyJSMHJERPWPVLBW-UHFFFAOYSA-N
MW240.31 g/mol
LogP2.18
Rot. Bonds3

About 2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylacetic acid

2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylacetic acid (PubChem CID 3654926) has the molecular formula C9H8N2O2S2 and a molecular weight of 240.31 g/mol. Its IUPAC name is 2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylacetic acid.

Molecular Properties

Compound Name2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylacetic acid
PubChem CID3654926
Molecular FormulaC9H8N2O2S2
Molecular Weight240.31 g/mol
Exact Mass240.00
IUPAC Name2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylacetic acid
SMILESCc1csc2c(SCC(=O)O)ncnc12
InChIInChI=1S/C9H8N2O2S2/c1-5-2-14-8-7(5)10-4-11-9(8)15-3-6(12)13/h2,4H,3H2,1H3,(H,12,13)
InChIKeyJSMHJERPWPVLBW-UHFFFAOYSA-N
XLogP2.18
TPSA63.08 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.31
LogP ≤ 52.18
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylacetic acid?
The IUPAC name of 2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylacetic acid (CID 3654926) is 2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylacetic acid.
What is the SMILES notation for 2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylacetic acid?
The canonical SMILES for 2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylacetic acid is Cc1csc2c(SCC(=O)O)ncnc12.
What is the InChIKey of 2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylacetic acid?
The InChIKey is JSMHJERPWPVLBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2S2/c1-5-2-14-8-7(5)10-4-11-9(8)15-3-6(12)13/h2,4H,3H2,1H3,(H,12,13).
What are the key properties of 2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylacetic acid?
2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylacetic acid has a molecular weight of 240.31 g/mol, XLogP of 2.18, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylacetic acid is sourced from PubChem (CID 3654926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).