About 2-(1,1-dioxothiolan-3-yl)-1H-pyridazine-3,6-dione
2-(1,1-dioxothiolan-3-yl)-1H-pyridazine-3,6-dione (PubChem CID 3655322) has the molecular formula C8H10N2O4S
and a molecular weight of 230.24 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-1H-pyridazine-3,6-dione.
Molecular Properties
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-1H-pyridazine-3,6-dione |
| PubChem CID | 3655322 |
| Molecular Formula | C8H10N2O4S |
| Molecular Weight | 230.24 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-1H-pyridazine-3,6-dione |
| SMILES | O=c1ccc(=O)n(C2CCS(=O)(=O)C2)[nH]1 |
| InChI | InChI=1S/C8H10N2O4S/c11-7-1-2-8(12)10(9-7)6-3-4-15(13,14)5-6/h1-2,6H,3-5H2,(H,9,11) |
| InChIKey | TVCFZOSMONZEEV-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 89.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.24 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1,1-dioxothiolan-3-yl)-1H-pyridazine-3,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,1-dioxothiolan-3-yl)-1H-pyridazine-3,6-dione?
The IUPAC name of 2-(1,1-dioxothiolan-3-yl)-1H-pyridazine-3,6-dione (CID 3655322) is 2-(1,1-dioxothiolan-3-yl)-1H-pyridazine-3,6-dione.
What is the SMILES notation for 2-(1,1-dioxothiolan-3-yl)-1H-pyridazine-3,6-dione?
The canonical SMILES for 2-(1,1-dioxothiolan-3-yl)-1H-pyridazine-3,6-dione is O=c1ccc(=O)n(C2CCS(=O)(=O)C2)[nH]1.
What is the InChIKey of 2-(1,1-dioxothiolan-3-yl)-1H-pyridazine-3,6-dione?
The InChIKey is TVCFZOSMONZEEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O4S/c11-7-1-2-8(12)10(9-7)6-3-4-15(13,14)5-6/h1-2,6H,3-5H2,(H,9,11).
What are the key properties of 2-(1,1-dioxothiolan-3-yl)-1H-pyridazine-3,6-dione?
2-(1,1-dioxothiolan-3-yl)-1H-pyridazine-3,6-dione has a molecular weight of 230.24 g/mol, XLogP of -1.10, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-dioxothiolan-3-yl)-1H-pyridazine-3,6-dione is sourced from PubChem (CID 3655322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).