C16H9ClF16O6S2 — CID 3655481
bis(2,2,3,3,4,4,5,5-octafluoropentyl) 4-chlorobenzene-1,3-disulfonate (PubChem CID 3655481) has the molecular formula C16H9ClF16O6S2 and a molecular weight of 700.80 g/mol. Its IUPAC name is bis(2,2,3,3,4,4,5,5-octafluoropentyl) 4-chlorobenzene-1,3-disulfonate.
| Compound Name | bis(2,2,3,3,4,4,5,5-octafluoropentyl) 4-chlorobenzene-1,3-disulfonate |
|---|---|
| PubChem CID | 3655481 |
| Molecular Formula | C16H9ClF16O6S2 |
| Molecular Weight | 700.80 g/mol |
| Exact Mass | 699.93 |
| IUPAC Name | bis(2,2,3,3,4,4,5,5-octafluoropentyl) 4-chlorobenzene-1,3-disulfonate |
| SMILES | O=S(=O)(OCC(F)(F)C(F)(F)C(F)(F)C(F)F)c1ccc(Cl)c(S(=O)(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C16H9ClF16O6S2/c17-7-2-1-6(40(34,35)38-4-11(22,23)15(30,31)13(26,27)9(18)19)3-8(7)41(36,37)39-5-12(24,25)16(32,33)14(28,29)10(20)21/h1-3,9-10H,4-5H2 |
| InChIKey | ZDEBPHSKMLQMPL-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.80 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|