C28H23N3O6 — CID 3655647
[1-(3-nitroanilino)-1-oxopropan-2-yl] 4-(furan-2-ylmethylidene)-2,3-dihydro-1H-acridine-9-carboxylate (PubChem CID 3655647) has the molecular formula C28H23N3O6 and a molecular weight of 497.51 g/mol. Its IUPAC name is [1-(3-nitroanilino)-1-oxopropan-2-yl] 4-(furan-2-ylmethylidene)-2,3-dihydro-1H-acridine-9-carboxylate.
| Compound Name | [1-(3-nitroanilino)-1-oxopropan-2-yl] 4-(furan-2-ylmethylidene)-2,3-dihydro-1H-acridine-9-carboxylate |
|---|---|
| PubChem CID | 3655647 |
| Molecular Formula | C28H23N3O6 |
| Molecular Weight | 497.51 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | [1-(3-nitroanilino)-1-oxopropan-2-yl] 4-(furan-2-ylmethylidene)-2,3-dihydro-1H-acridine-9-carboxylate |
| SMILES | CC(OC(=O)c1c2c(nc3ccccc13)C(=Cc1ccco1)CCC2)C(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H23N3O6/c1-17(27(32)29-19-8-5-9-20(16-19)31(34)35)37-28(33)25-22-11-2-3-13-24(22)30-26-18(7-4-12-23(25)26)15-21-10-6-14-36-21/h2-3,5-6,8-11,13-17H,4,7,12H2,1H3,(H,29,32) |
| InChIKey | PKZHXQTZXJNLMR-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 124.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.51 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|