About 1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl-(7-fluoro-3-methyl-1-benzofuran-2-yl)methanone
1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl-(7-fluoro-3-methyl-1-benzofuran-2-yl)methanone (PubChem CID 36566276) has the molecular formula C19H14FN3O2
and a molecular weight of 335.34 g/mol. Its IUPAC name is 1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl-(7-fluoro-3-methyl-1-benzofuran-2-yl)methanone.
Molecular Properties
| Compound Name | 1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl-(7-fluoro-3-methyl-1-benzofuran-2-yl)methanone |
| PubChem CID | 36566276 |
| Molecular Formula | C19H14FN3O2 |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl-(7-fluoro-3-methyl-1-benzofuran-2-yl)methanone |
| SMILES | Cc1c(C(=O)N2CCn3c2nc2ccccc23)oc2c(F)cccc12 |
| InChI | InChI=1S/C19H14FN3O2/c1-11-12-5-4-6-13(20)17(12)25-16(11)18(24)23-10-9-22-15-8-3-2-7-14(15)21-19(22)23/h2-8H,9-10H2,1H3 |
| InChIKey | LYPFENNHRCMZAP-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 51.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl-(7-fluoro-3-methyl-1-benzofuran-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl-(7-fluoro-3-methyl-1-benzofuran-2-yl)methanone?
The IUPAC name of 1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl-(7-fluoro-3-methyl-1-benzofuran-2-yl)methanone (CID 36566276) is 1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl-(7-fluoro-3-methyl-1-benzofuran-2-yl)methanone.
What is the SMILES notation for 1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl-(7-fluoro-3-methyl-1-benzofuran-2-yl)methanone?
The canonical SMILES for 1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl-(7-fluoro-3-methyl-1-benzofuran-2-yl)methanone is Cc1c(C(=O)N2CCn3c2nc2ccccc23)oc2c(F)cccc12.
What is the InChIKey of 1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl-(7-fluoro-3-methyl-1-benzofuran-2-yl)methanone?
The InChIKey is LYPFENNHRCMZAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14FN3O2/c1-11-12-5-4-6-13(20)17(12)25-16(11)18(24)23-10-9-22-15-8-3-2-7-14(15)21-19(22)23/h2-8H,9-10H2,1H3.
What are the key properties of 1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl-(7-fluoro-3-methyl-1-benzofuran-2-yl)methanone?
1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl-(7-fluoro-3-methyl-1-benzofuran-2-yl)methanone has a molecular weight of 335.34 g/mol, XLogP of 3.89, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl-(7-fluoro-3-methyl-1-benzofuran-2-yl)methanone is sourced from PubChem (CID 36566276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).