C20H30N2O3 — CID 36567839
N-[4-(4-cyclopentyloxyanilino)-4-oxobutyl]-2,2-dimethylpropanamide (PubChem CID 36567839) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is N-[4-(4-cyclopentyloxyanilino)-4-oxobutyl]-2,2-dimethylpropanamide.
| Compound Name | N-[4-(4-cyclopentyloxyanilino)-4-oxobutyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 36567839 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | N-[4-(4-cyclopentyloxyanilino)-4-oxobutyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NCCCC(=O)Nc1ccc(OC2CCCC2)cc1 |
| InChI | InChI=1S/C20H30N2O3/c1-20(2,3)19(24)21-14-6-9-18(23)22-15-10-12-17(13-11-15)25-16-7-4-5-8-16/h10-13,16H,4-9,14H2,1-3H3,(H,21,24)(H,22,23) |
| InChIKey | YFBGTKDFONRKHC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|