About 2-imino-1,3-dimethylindol-3-ol
2-imino-1,3-dimethylindol-3-ol (PubChem CID 3656896) has the molecular formula C10H12N2O
and a molecular weight of 176.22 g/mol. Its IUPAC name is 2-imino-1,3-dimethylindol-3-ol.
Molecular Properties
| Compound Name | 2-imino-1,3-dimethylindol-3-ol |
| PubChem CID | 3656896 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 2-imino-1,3-dimethylindol-3-ol |
| SMILES | [H]/N=C1\N(C)c2ccccc2C1(C)O |
| InChI | InChI=1S/C10H12N2O/c1-10(13)7-5-3-4-6-8(7)12(2)9(10)11/h3-6,11,13H,1-2H3/b11-9- |
| InChIKey | HHZOZABBHNCTBU-LUAWRHEFSA-N |
| XLogP | 1.32 |
| TPSA | 47.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-imino-1,3-dimethylindol-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-imino-1,3-dimethylindol-3-ol?
The IUPAC name of 2-imino-1,3-dimethylindol-3-ol (CID 3656896) is 2-imino-1,3-dimethylindol-3-ol.
What is the SMILES notation for 2-imino-1,3-dimethylindol-3-ol?
The canonical SMILES for 2-imino-1,3-dimethylindol-3-ol is [H]/N=C1\N(C)c2ccccc2C1(C)O.
What is the InChIKey of 2-imino-1,3-dimethylindol-3-ol?
The InChIKey is HHZOZABBHNCTBU-LUAWRHEFSA-N. The full InChI is InChI=1S/C10H12N2O/c1-10(13)7-5-3-4-6-8(7)12(2)9(10)11/h3-6,11,13H,1-2H3/b11-9-.
What are the key properties of 2-imino-1,3-dimethylindol-3-ol?
2-imino-1,3-dimethylindol-3-ol has a molecular weight of 176.22 g/mol, XLogP of 1.32, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imino-1,3-dimethylindol-3-ol is sourced from PubChem (CID 3656896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).