About bis(2-methoxyethyl) 2-(4-chlorophenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate
bis(2-methoxyethyl) 2-(4-chlorophenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate (PubChem CID 3657598) has the molecular formula C21H27ClO8
and a molecular weight of 442.89 g/mol. Its IUPAC name is bis(2-methoxyethyl) 2-(4-chlorophenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate.
Molecular Properties
| Compound Name | bis(2-methoxyethyl) 2-(4-chlorophenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate |
| PubChem CID | 3657598 |
| Molecular Formula | C21H27ClO8 |
| Molecular Weight | 442.89 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | bis(2-methoxyethyl) 2-(4-chlorophenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate |
| SMILES | COCCOC(=O)C1C(=O)CC(C)(O)C(C(=O)OCCOC)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H27ClO8/c1-21(26)12-15(23)17(19(24)29-10-8-27-2)16(13-4-6-14(22)7-5-13)18(21)20(25)30-11-9-28-3/h4-7,16-18,26H,8-12H2,1-3H3 |
| InChIKey | XDEMGJMCDOZVRB-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.89 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze bis(2-methoxyethyl) 2-(4-chlorophenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methoxyethyl) 2-(4-chlorophenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate?
The IUPAC name of bis(2-methoxyethyl) 2-(4-chlorophenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate (CID 3657598) is bis(2-methoxyethyl) 2-(4-chlorophenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate.
What is the SMILES notation for bis(2-methoxyethyl) 2-(4-chlorophenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate?
The canonical SMILES for bis(2-methoxyethyl) 2-(4-chlorophenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate is COCCOC(=O)C1C(=O)CC(C)(O)C(C(=O)OCCOC)C1c1ccc(Cl)cc1.
What is the InChIKey of bis(2-methoxyethyl) 2-(4-chlorophenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate?
The InChIKey is XDEMGJMCDOZVRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27ClO8/c1-21(26)12-15(23)17(19(24)29-10-8-27-2)16(13-4-6-14(22)7-5-13)18(21)20(25)30-11-9-28-3/h4-7,16-18,26H,8-12H2,1-3H3.
What are the key properties of bis(2-methoxyethyl) 2-(4-chlorophenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate?
bis(2-methoxyethyl) 2-(4-chlorophenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate has a molecular weight of 442.89 g/mol, XLogP of 1.76, 9 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methoxyethyl) 2-(4-chlorophenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate is sourced from PubChem (CID 3657598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).