C24H60N9P3 — CID 3657757
2-N,2-N,2-N',2-N',4-N,4-N,4-N',4-N',6-N,6-N,6-N',6-N'-dodecaethyl-1,3,5-triaza-2lambda5,4lambda5,6lambda5-triphosphacyclohexa-1,3,5-triene-2,2,4,4,6,6-hexamine (PubChem CID 3657757) has the molecular formula C24H60N9P3 and a molecular weight of 567.73 g/mol. Its IUPAC name is 2-N,2-N,2-N',2-N',4-N,4-N,4-N',4-N',6-N,6-N,6-N',6-N'-dodecaethyl-1,3,5-triaza-2lambda5,4lambda5,6lambda5-triphosphacyclohexa-1,3,5-triene-2,2,4,4,6,6-hexamine.
| Compound Name | 2-N,2-N,2-N',2-N',4-N,4-N,4-N',4-N',6-N,6-N,6-N',6-N'-dodecaethyl-1,3,5-triaza-2lambda5,4lambda5,6lambda5-triphosphacyclohexa-1,3,5-triene-2,2,4,4,6,6-hexamine |
|---|---|
| PubChem CID | 3657757 |
| Molecular Formula | C24H60N9P3 |
| Molecular Weight | 567.73 g/mol |
| Exact Mass | 567.42 |
| IUPAC Name | 2-N,2-N,2-N',2-N',4-N,4-N,4-N',4-N',6-N,6-N,6-N',6-N'-dodecaethyl-1,3,5-triaza-2lambda5,4lambda5,6lambda5-triphosphacyclohexa-1,3,5-triene-2,2,4,4,6,6-hexamine |
| SMILES | CCN(CC)P1(N(CC)CC)=NP(N(CC)CC)(N(CC)CC)=NP(N(CC)CC)(N(CC)CC)=N1 |
| InChI | InChI=1S/C24H60N9P3/c1-13-28(14-2)34(29(15-3)16-4)25-35(30(17-5)18-6,31(19-7)20-8)27-36(26-34,32(21-9)22-10)33(23-11)24-12/h13-24H2,1-12H3 |
| InChIKey | KUCGBYLUQWCSBS-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 56.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.73 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|