C23H18N4O4S — CID 36578330
[5-[(4-methoxyphenyl)carbamoyl]-1,3,4-thiadiazol-2-yl]methyl (E)-3-quinolin-2-ylprop-2-enoate (PubChem CID 36578330) has the molecular formula C23H18N4O4S and a molecular weight of 446.49 g/mol. Its IUPAC name is [5-[(4-methoxyphenyl)carbamoyl]-1,3,4-thiadiazol-2-yl]methyl (E)-3-quinolin-2-ylprop-2-enoate.
| Compound Name | [5-[(4-methoxyphenyl)carbamoyl]-1,3,4-thiadiazol-2-yl]methyl (E)-3-quinolin-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 36578330 |
| Molecular Formula | C23H18N4O4S |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | [5-[(4-methoxyphenyl)carbamoyl]-1,3,4-thiadiazol-2-yl]methyl (E)-3-quinolin-2-ylprop-2-enoate |
| SMILES | COc1ccc(NC(=O)c2nnc(COC(=O)/C=C/c3ccc4ccccc4n3)s2)cc1 |
| InChI | InChI=1S/C23H18N4O4S/c1-30-18-11-8-17(9-12-18)25-22(29)23-27-26-20(32-23)14-31-21(28)13-10-16-7-6-15-4-2-3-5-19(15)24-16/h2-13H,14H2,1H3,(H,25,29)/b13-10+ |
| InChIKey | AZROMXYBEZQJRZ-JLHYYAGUSA-N |
| XLogP | 4.10 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|