About [2-(4-methyl-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2-thiophen-3-ylacetate
[2-(4-methyl-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2-thiophen-3-ylacetate (PubChem CID 3658108) has the molecular formula C19H22N2O6S2
and a molecular weight of 438.53 g/mol. Its IUPAC name is [2-(4-methyl-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2-thiophen-3-ylacetate.
Molecular Properties
| Compound Name | [2-(4-methyl-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2-thiophen-3-ylacetate |
| PubChem CID | 3658108 |
| Molecular Formula | C19H22N2O6S2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | [2-(4-methyl-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2-thiophen-3-ylacetate |
| SMILES | Cc1ccc(NC(=O)COC(=O)Cc2ccsc2)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C19H22N2O6S2/c1-14-2-3-16(11-17(14)29(24,25)21-5-7-26-8-6-21)20-18(22)12-27-19(23)10-15-4-9-28-13-15/h2-4,9,11,13H,5-8,10,12H2,1H3,(H,20,22) |
| InChIKey | GTZWVHOTMMFHMR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [2-(4-methyl-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2-thiophen-3-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-methyl-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2-thiophen-3-ylacetate?
The IUPAC name of [2-(4-methyl-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2-thiophen-3-ylacetate (CID 3658108) is [2-(4-methyl-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2-thiophen-3-ylacetate.
What is the SMILES notation for [2-(4-methyl-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2-thiophen-3-ylacetate?
The canonical SMILES for [2-(4-methyl-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2-thiophen-3-ylacetate is Cc1ccc(NC(=O)COC(=O)Cc2ccsc2)cc1S(=O)(=O)N1CCOCC1.
What is the InChIKey of [2-(4-methyl-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2-thiophen-3-ylacetate?
The InChIKey is GTZWVHOTMMFHMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O6S2/c1-14-2-3-16(11-17(14)29(24,25)21-5-7-26-8-6-21)20-18(22)12-27-19(23)10-15-4-9-28-13-15/h2-4,9,11,13H,5-8,10,12H2,1H3,(H,20,22).
What are the key properties of [2-(4-methyl-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2-thiophen-3-ylacetate?
[2-(4-methyl-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2-thiophen-3-ylacetate has a molecular weight of 438.53 g/mol, XLogP of 1.80, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-methyl-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2-thiophen-3-ylacetate is sourced from PubChem (CID 3658108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).