C14H13N3O2S — CID 3658662
N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-4-methoxybenzamide (PubChem CID 3658662) has the molecular formula C14H13N3O2S and a molecular weight of 287.34 g/mol. Its IUPAC name is N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-4-methoxybenzamide.
| Compound Name | N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 3658662 |
| Molecular Formula | C14H13N3O2S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NCc2cn3ccsc3n2)cc1 |
| InChI | InChI=1S/C14H13N3O2S/c1-19-12-4-2-10(3-5-12)13(18)15-8-11-9-17-6-7-20-14(17)16-11/h2-7,9H,8H2,1H3,(H,15,18) |
| InChIKey | XHILFNTYRBWGHL-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |