About 5-nitro-1-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]pyridin-2-one
5-nitro-1-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]pyridin-2-one (PubChem CID 36588904) has the molecular formula C11H12N4O4
and a molecular weight of 264.24 g/mol. Its IUPAC name is 5-nitro-1-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]pyridin-2-one.
Molecular Properties
| Compound Name | 5-nitro-1-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]pyridin-2-one |
| PubChem CID | 36588904 |
| Molecular Formula | C11H12N4O4 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 5-nitro-1-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]pyridin-2-one |
| SMILES | CCCc1noc(Cn2cc([N+](=O)[O-])ccc2=O)n1 |
| InChI | InChI=1S/C11H12N4O4/c1-2-3-9-12-10(19-13-9)7-14-6-8(15(17)18)4-5-11(14)16/h4-6H,2-3,7H2,1H3 |
| InChIKey | ZWNXUMQRTGMKMC-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 104.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitro-1-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitro-1-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]pyridin-2-one?
The IUPAC name of 5-nitro-1-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]pyridin-2-one (CID 36588904) is 5-nitro-1-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]pyridin-2-one.
What is the SMILES notation for 5-nitro-1-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]pyridin-2-one?
The canonical SMILES for 5-nitro-1-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]pyridin-2-one is CCCc1noc(Cn2cc([N+](=O)[O-])ccc2=O)n1.
What is the InChIKey of 5-nitro-1-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]pyridin-2-one?
The InChIKey is ZWNXUMQRTGMKMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4O4/c1-2-3-9-12-10(19-13-9)7-14-6-8(15(17)18)4-5-11(14)16/h4-6H,2-3,7H2,1H3.
What are the key properties of 5-nitro-1-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]pyridin-2-one?
5-nitro-1-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]pyridin-2-one has a molecular weight of 264.24 g/mol, XLogP of 1.14, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitro-1-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]pyridin-2-one is sourced from PubChem (CID 36588904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).