About N-naphthalen-1-yl-2-(1,3,3-trimethylindol-2-ylidene)ethanethioamide
N-naphthalen-1-yl-2-(1,3,3-trimethylindol-2-ylidene)ethanethioamide (PubChem CID 3659255) has the molecular formula C23H22N2S
and a molecular weight of 358.51 g/mol. Its IUPAC name is N-naphthalen-1-yl-2-(1,3,3-trimethylindol-2-ylidene)ethanethioamide.
Molecular Properties
| Compound Name | N-naphthalen-1-yl-2-(1,3,3-trimethylindol-2-ylidene)ethanethioamide |
| PubChem CID | 3659255 |
| Molecular Formula | C23H22N2S |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | N-naphthalen-1-yl-2-(1,3,3-trimethylindol-2-ylidene)ethanethioamide |
| SMILES | CN1C(=CC(=S)Nc2cccc3ccccc23)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C23H22N2S/c1-23(2)18-12-6-7-14-20(18)25(3)21(23)15-22(26)24-19-13-8-10-16-9-4-5-11-17(16)19/h4-15H,1-3H3,(H,24,26) |
| InChIKey | ZRYLWVHWQRHXGX-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-naphthalen-1-yl-2-(1,3,3-trimethylindol-2-ylidene)ethanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-naphthalen-1-yl-2-(1,3,3-trimethylindol-2-ylidene)ethanethioamide?
The IUPAC name of N-naphthalen-1-yl-2-(1,3,3-trimethylindol-2-ylidene)ethanethioamide (CID 3659255) is N-naphthalen-1-yl-2-(1,3,3-trimethylindol-2-ylidene)ethanethioamide.
What is the SMILES notation for N-naphthalen-1-yl-2-(1,3,3-trimethylindol-2-ylidene)ethanethioamide?
The canonical SMILES for N-naphthalen-1-yl-2-(1,3,3-trimethylindol-2-ylidene)ethanethioamide is CN1C(=CC(=S)Nc2cccc3ccccc23)C(C)(C)c2ccccc21.
What is the InChIKey of N-naphthalen-1-yl-2-(1,3,3-trimethylindol-2-ylidene)ethanethioamide?
The InChIKey is ZRYLWVHWQRHXGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N2S/c1-23(2)18-12-6-7-14-20(18)25(3)21(23)15-22(26)24-19-13-8-10-16-9-4-5-11-17(16)19/h4-15H,1-3H3,(H,24,26).
What are the key properties of N-naphthalen-1-yl-2-(1,3,3-trimethylindol-2-ylidene)ethanethioamide?
N-naphthalen-1-yl-2-(1,3,3-trimethylindol-2-ylidene)ethanethioamide has a molecular weight of 358.51 g/mol, XLogP of 5.89, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-naphthalen-1-yl-2-(1,3,3-trimethylindol-2-ylidene)ethanethioamide is sourced from PubChem (CID 3659255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).