C14H14N2O3S2 — CID 3659340
methyl 3-[(4-methoxyphenyl)carbamothioylamino]thiophene-2-carboxylate (PubChem CID 3659340) has the molecular formula C14H14N2O3S2 and a molecular weight of 322.41 g/mol. Its IUPAC name is methyl 3-[(4-methoxyphenyl)carbamothioylamino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[(4-methoxyphenyl)carbamothioylamino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 3659340 |
| Molecular Formula | C14H14N2O3S2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | methyl 3-[(4-methoxyphenyl)carbamothioylamino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=S)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C14H14N2O3S2/c1-18-10-5-3-9(4-6-10)15-14(20)16-11-7-8-21-12(11)13(17)19-2/h3-8H,1-2H3,(H2,15,16,20) |
| InChIKey | WRNAZIURTAIUPL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|