C20H18N4O2 — CID 3659388
6-methyl-2-oxo-N-(2-phenylethyl)-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide (PubChem CID 3659388) has the molecular formula C20H18N4O2 and a molecular weight of 346.39 g/mol. Its IUPAC name is 6-methyl-2-oxo-N-(2-phenylethyl)-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide.
| Compound Name | 6-methyl-2-oxo-N-(2-phenylethyl)-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide |
|---|---|
| PubChem CID | 3659388 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 6-methyl-2-oxo-N-(2-phenylethyl)-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide |
| SMILES | Cn1c(C(=O)NCCc2ccccc2)cc2c(=O)n3ccccc3nc21 |
| InChI | InChI=1S/C20H18N4O2/c1-23-16(19(25)21-11-10-14-7-3-2-4-8-14)13-15-18(23)22-17-9-5-6-12-24(17)20(15)26/h2-9,12-13H,10-11H2,1H3,(H,21,25) |
| InChIKey | YYLNWHDRODWDKV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 68.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |