C8H10N2O3S — CID 3659581
ethyl 2-(4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)acetate (PubChem CID 3659581) has the molecular formula C8H10N2O3S and a molecular weight of 214.25 g/mol. Its IUPAC name is ethyl 2-(4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)acetate.
| Compound Name | ethyl 2-(4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)acetate |
|---|---|
| PubChem CID | 3659581 |
| Molecular Formula | C8H10N2O3S |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | ethyl 2-(4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)acetate |
| SMILES | CCOC(=O)Cc1c[nH]c(=S)[nH]c1=O |
| InChI | InChI=1S/C8H10N2O3S/c1-2-13-6(11)3-5-4-9-8(14)10-7(5)12/h4H,2-3H2,1H3,(H2,9,10,12,14) |
| InChIKey | AZQJLAUOZFTBTH-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|