C19H19NO2S2 — CID 3659648
5-[(4-methylphenyl)methylsulfanylmethyl]-N-(thiophen-2-ylmethyl)furan-2-carboxamide (PubChem CID 3659648) has the molecular formula C19H19NO2S2 and a molecular weight of 357.50 g/mol. Its IUPAC name is 5-[(4-methylphenyl)methylsulfanylmethyl]-N-(thiophen-2-ylmethyl)furan-2-carboxamide.
| Compound Name | 5-[(4-methylphenyl)methylsulfanylmethyl]-N-(thiophen-2-ylmethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 3659648 |
| Molecular Formula | C19H19NO2S2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 5-[(4-methylphenyl)methylsulfanylmethyl]-N-(thiophen-2-ylmethyl)furan-2-carboxamide |
| SMILES | Cc1ccc(CSCc2ccc(C(=O)NCc3cccs3)o2)cc1 |
| InChI | InChI=1S/C19H19NO2S2/c1-14-4-6-15(7-5-14)12-23-13-16-8-9-18(22-16)19(21)20-11-17-3-2-10-24-17/h2-10H,11-13H2,1H3,(H,20,21) |
| InChIKey | NHJIIGORUZGPOU-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |