About Levmetamfetamine
Levmetamfetamine (PubChem CID 36604) has the molecular formula C10H15N
and a molecular weight of 149.23 g/mol. Its IUPAC name is (2R)-N-methyl-1-phenylpropan-2-amine.
Molecular Properties
| Compound Name | Levmetamfetamine |
|---|
| PubChem CID | 36604 |
|---|
| Molecular Formula | C10H15N |
|---|
| Molecular Weight | 149.23 g/mol |
|---|
| Exact Mass | 149.12 |
|---|
| IUPAC Name | (2R)-N-methyl-1-phenylpropan-2-amine |
|---|
| SMILES | C[C@H](CC1=CC=CC=C1)NC |
|---|
| InChI | InChI=1S/C10H15N/c1-9(11-2)8-10-6-4-3-5-7-10/h3-7,9,11H,8H2,1-2H3/t9-/m1/s1 |
|---|
| InChIKey | MYWUZJCMWCOHBA-SECBINFHSA-N |
|---|
| XLogP | 2.10 |
|---|
| TPSA | 12.00 Ų |
|---|
| H-Bond Donors | 1 |
|---|
| H-Bond Acceptors | 1 |
|---|
| Rotatable Bonds | 3 |
|---|
| Heavy Atoms | 11 |
|---|
| Complexity | 95 |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 149.23 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze Levmetamfetamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Levmetamfetamine?
The IUPAC name of Levmetamfetamine (CID 36604) is (2R)-N-methyl-1-phenylpropan-2-amine.
What is the SMILES notation for Levmetamfetamine?
The canonical SMILES for Levmetamfetamine is C[C@H](CC1=CC=CC=C1)NC.
What is the InChIKey of Levmetamfetamine?
The InChIKey is MYWUZJCMWCOHBA-SECBINFHSA-N. The full InChI is InChI=1S/C10H15N/c1-9(11-2)8-10-6-4-3-5-7-10/h3-7,9,11H,8H2,1-2H3/t9-/m1/s1.
What are the key properties of Levmetamfetamine?
Levmetamfetamine has a molecular weight of 149.23 g/mol, XLogP of 2.10, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Levmetamfetamine is sourced from PubChem (CID 36604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).