C19H18Cl2O4 — CID 3661142
3,9-bis(3-chlorophenyl)-2,4,8,10-tetraoxaspiro[5.5]undecane (PubChem CID 3661142) has the molecular formula C19H18Cl2O4 and a molecular weight of 381.25 g/mol. Its IUPAC name is 3,9-bis(3-chlorophenyl)-2,4,8,10-tetraoxaspiro[5.5]undecane.
| Compound Name | 3,9-bis(3-chlorophenyl)-2,4,8,10-tetraoxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 3661142 |
| Molecular Formula | C19H18Cl2O4 |
| Molecular Weight | 381.25 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | 3,9-bis(3-chlorophenyl)-2,4,8,10-tetraoxaspiro[5.5]undecane |
| SMILES | Clc1cccc(C2OCC3(CO2)COC(c2cccc(Cl)c2)OC3)c1 |
| InChI | InChI=1S/C19H18Cl2O4/c20-15-5-1-3-13(7-15)17-22-9-19(10-23-17)11-24-18(25-12-19)14-4-2-6-16(21)8-14/h1-8,17-18H,9-12H2 |
| InChIKey | UMEKZMXMDGCPQP-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.25 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |