About N'-hydroxyoctanimidamide
N'-hydroxyoctanimidamide (PubChem CID 3661326) has the molecular formula C8H18N2O
and a molecular weight of 158.25 g/mol. Its IUPAC name is N'-hydroxyoctanimidamide.
Molecular Properties
| Compound Name | N'-hydroxyoctanimidamide |
| PubChem CID | 3661326 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.25 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | N'-hydroxyoctanimidamide |
| SMILES | CCCCCCCC(N)=NO |
| InChI | InChI=1S/C8H18N2O/c1-2-3-4-5-6-7-8(9)10-11/h11H,2-7H2,1H3,(H2,9,10) |
| InChIKey | JFADPFVOUUHJPK-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.25 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-hydroxyoctanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-hydroxyoctanimidamide?
The IUPAC name of N'-hydroxyoctanimidamide (CID 3661326) is N'-hydroxyoctanimidamide.
What is the SMILES notation for N'-hydroxyoctanimidamide?
The canonical SMILES for N'-hydroxyoctanimidamide is CCCCCCCC(N)=NO.
What is the InChIKey of N'-hydroxyoctanimidamide?
The InChIKey is JFADPFVOUUHJPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O/c1-2-3-4-5-6-7-8(9)10-11/h11H,2-7H2,1H3,(H2,9,10).
What are the key properties of N'-hydroxyoctanimidamide?
N'-hydroxyoctanimidamide has a molecular weight of 158.25 g/mol, XLogP of 2.09, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-hydroxyoctanimidamide is sourced from PubChem (CID 3661326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).