C25H24N2O3 — CID 36615147
[4-(4-phenoxybenzoyl)-1,4-diazepan-1-yl]-phenylmethanone (PubChem CID 36615147) has the molecular formula C25H24N2O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is [4-(4-phenoxybenzoyl)-1,4-diazepan-1-yl]-phenylmethanone.
| Compound Name | [4-(4-phenoxybenzoyl)-1,4-diazepan-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 36615147 |
| Molecular Formula | C25H24N2O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | [4-(4-phenoxybenzoyl)-1,4-diazepan-1-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1CCCN(C(=O)c2ccc(Oc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C25H24N2O3/c28-24(20-8-3-1-4-9-20)26-16-7-17-27(19-18-26)25(29)21-12-14-23(15-13-21)30-22-10-5-2-6-11-22/h1-6,8-15H,7,16-19H2 |
| InChIKey | DTIUDQPFIQBTAD-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |