About 4-(2-oxo-1,3-dioxolan-4-yl)-1,3-dioxolan-2-one
4-(2-oxo-1,3-dioxolan-4-yl)-1,3-dioxolan-2-one (PubChem CID 3661569) has the molecular formula C6H6O6
and a molecular weight of 174.11 g/mol. Its IUPAC name is 4-(2-oxo-1,3-dioxolan-4-yl)-1,3-dioxolan-2-one.
Molecular Properties
| Compound Name | 4-(2-oxo-1,3-dioxolan-4-yl)-1,3-dioxolan-2-one |
| PubChem CID | 3661569 |
| Molecular Formula | C6H6O6 |
| Molecular Weight | 174.11 g/mol |
| Exact Mass | 174.02 |
| IUPAC Name | 4-(2-oxo-1,3-dioxolan-4-yl)-1,3-dioxolan-2-one |
| SMILES | O=C1OCC(C2COC(=O)O2)O1 |
| InChI | InChI=1S/C6H6O6/c7-5-9-1-3(11-5)4-2-10-6(8)12-4/h3-4H,1-2H2 |
| InChIKey | ZWGIZHOZSXFSNW-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.11 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(2-oxo-1,3-dioxolan-4-yl)-1,3-dioxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-oxo-1,3-dioxolan-4-yl)-1,3-dioxolan-2-one?
The IUPAC name of 4-(2-oxo-1,3-dioxolan-4-yl)-1,3-dioxolan-2-one (CID 3661569) is 4-(2-oxo-1,3-dioxolan-4-yl)-1,3-dioxolan-2-one.
What is the SMILES notation for 4-(2-oxo-1,3-dioxolan-4-yl)-1,3-dioxolan-2-one?
The canonical SMILES for 4-(2-oxo-1,3-dioxolan-4-yl)-1,3-dioxolan-2-one is O=C1OCC(C2COC(=O)O2)O1.
What is the InChIKey of 4-(2-oxo-1,3-dioxolan-4-yl)-1,3-dioxolan-2-one?
The InChIKey is ZWGIZHOZSXFSNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O6/c7-5-9-1-3(11-5)4-2-10-6(8)12-4/h3-4H,1-2H2.
What are the key properties of 4-(2-oxo-1,3-dioxolan-4-yl)-1,3-dioxolan-2-one?
4-(2-oxo-1,3-dioxolan-4-yl)-1,3-dioxolan-2-one has a molecular weight of 174.11 g/mol, XLogP of 0.06, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-oxo-1,3-dioxolan-4-yl)-1,3-dioxolan-2-one is sourced from PubChem (CID 3661569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).