C29H29F3N2O3S — CID 3662140
[4-[[6-tert-butyl-3-[[3-(trifluoromethyl)phenyl]carbamoyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]iminomethyl]phenyl] acetate (PubChem CID 3662140) has the molecular formula C29H29F3N2O3S and a molecular weight of 542.62 g/mol. Its IUPAC name is [4-[[6-tert-butyl-3-[[3-(trifluoromethyl)phenyl]carbamoyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]iminomethyl]phenyl] acetate.
| Compound Name | [4-[[6-tert-butyl-3-[[3-(trifluoromethyl)phenyl]carbamoyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]iminomethyl]phenyl] acetate |
|---|---|
| PubChem CID | 3662140 |
| Molecular Formula | C29H29F3N2O3S |
| Molecular Weight | 542.62 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | [4-[[6-tert-butyl-3-[[3-(trifluoromethyl)phenyl]carbamoyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]iminomethyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C=Nc2sc3c(c2C(=O)Nc2cccc(C(F)(F)F)c2)CCC(C(C)(C)C)C3)cc1 |
| InChI | InChI=1S/C29H29F3N2O3S/c1-17(35)37-22-11-8-18(9-12-22)16-33-27-25(23-13-10-19(28(2,3)4)15-24(23)38-27)26(36)34-21-7-5-6-20(14-21)29(30,31)32/h5-9,11-12,14,16,19H,10,13,15H2,1-4H3,(H,34,36) |
| InChIKey | SFDLZZJUVQENJR-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.62 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|